C12H9N3O3S — CID 62684138
3-(1,3-benzodioxol-5-yloxy)pyrazine-2-carbothioamide (PubChem CID 62684138) has the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yloxy)pyrazine-2-carbothioamide.
| Compound Name | 3-(1,3-benzodioxol-5-yloxy)pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 62684138 |
| Molecular Formula | C12H9N3O3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yloxy)pyrazine-2-carbothioamide |
| SMILES | NC(=S)c1nccnc1Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H9N3O3S/c13-11(19)10-12(15-4-3-14-10)18-7-1-2-8-9(5-7)17-6-16-8/h1-5H,6H2,(H2,13,19) |
| InChIKey | FAUXAMVTASJTRW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|