C11H9N3O3 — CID 80881241
4-(1,3-benzodioxol-5-yloxy)pyrimidin-2-amine (PubChem CID 80881241) has the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yloxy)pyrimidin-2-amine.
| Compound Name | 4-(1,3-benzodioxol-5-yloxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80881241 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yloxy)pyrimidin-2-amine |
| SMILES | Nc1nccc(Oc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C11H9N3O3/c12-11-13-4-3-10(14-11)17-7-1-2-8-9(5-7)16-6-15-8/h1-5H,6H2,(H2,12,13,14) |
| InChIKey | NEHOIPDSFITDSU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |