C14H10FNO5 — CID 18629122
methyl 6-(1,3-benzodioxol-5-yloxy)-2-fluoropyridine-3-carboxylate (PubChem CID 18629122) has the molecular formula C14H10FNO5 and a molecular weight of 291.23 g/mol. Its IUPAC name is methyl 6-(1,3-benzodioxol-5-yloxy)-2-fluoropyridine-3-carboxylate.
| Compound Name | methyl 6-(1,3-benzodioxol-5-yloxy)-2-fluoropyridine-3-carboxylate |
|---|---|
| PubChem CID | 18629122 |
| Molecular Formula | C14H10FNO5 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | methyl 6-(1,3-benzodioxol-5-yloxy)-2-fluoropyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(Oc2ccc3c(c2)OCO3)nc1F |
| InChI | InChI=1S/C14H10FNO5/c1-18-14(17)9-3-5-12(16-13(9)15)21-8-2-4-10-11(6-8)20-7-19-10/h2-6H,7H2,1H3 |
| InChIKey | BZGGYOOMNIZCSM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|