methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate

C16H14O5 — CID 625404

IUPACmethyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate
SMILESCOC(=O)c1cc2c(cc1-c1ccc(OC)cc1)OCO2
InChIInChI=1S/C16H14O5/c1-18-11-5-3-10(4-6-11)12-7-14-15(21-9-20-14)8-13(12)16(17)19-2/h3-8H,9H2,1-2H3
InChIKeyYACCAKNECSHUGS-UHFFFAOYSA-N
MW286.28 g/mol
LogP2.88
Rot. Bonds3

About methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate

methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate (PubChem CID 625404) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Namemethyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate
PubChem CID625404
Molecular FormulaC16H14O5
Molecular Weight286.28 g/mol
Exact Mass286.08
IUPAC Namemethyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate
SMILESCOC(=O)c1cc2c(cc1-c1ccc(OC)cc1)OCO2
InChIInChI=1S/C16H14O5/c1-18-11-5-3-10(4-6-11)12-7-14-15(21-9-20-14)8-13(12)16(17)19-2/h3-8H,9H2,1-2H3
InChIKeyYACCAKNECSHUGS-UHFFFAOYSA-N
XLogP2.88
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.28
LogP ≤ 52.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate?
The IUPAC name of methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate (CID 625404) is methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate?
The canonical SMILES for methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate is COC(=O)c1cc2c(cc1-c1ccc(OC)cc1)OCO2.
What is the InChIKey of methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate?
The InChIKey is YACCAKNECSHUGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O5/c1-18-11-5-3-10(4-6-11)12-7-14-15(21-9-20-14)8-13(12)16(17)19-2/h3-8H,9H2,1-2H3.
What are the key properties of methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate?
methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate has a molecular weight of 286.28 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(4-methoxyphenyl)-1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 625404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).