C16H12O7 — CID 643011
1-(6-hydroxy-1,3-benzodioxol-5-yl)-2-(2-hydroxy-4-methoxyphenyl)ethane-1,2-dione (PubChem CID 643011) has the molecular formula C16H12O7 and a molecular weight of 316.26 g/mol. Its IUPAC name is 1-(6-hydroxy-1,3-benzodioxol-5-yl)-2-(2-hydroxy-4-methoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-(6-hydroxy-1,3-benzodioxol-5-yl)-2-(2-hydroxy-4-methoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 643011 |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-(6-hydroxy-1,3-benzodioxol-5-yl)-2-(2-hydroxy-4-methoxyphenyl)ethane-1,2-dione |
| SMILES | COc1ccc(C(=O)C(=O)c2cc3c(cc2O)OCO3)c(O)c1 |
| InChI | InChI=1S/C16H12O7/c1-21-8-2-3-9(11(17)4-8)15(19)16(20)10-5-13-14(6-12(10)18)23-7-22-13/h2-6,17-18H,7H2,1H3 |
| InChIKey | LIBXIJWGDDLJBP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|