C18H16O7 — CID 91137834
1-(1,3-benzodioxol-5-yl)-3-(2-hydroxy-4-methoxyphenyl)-2-methoxypropane-1,3-dione (PubChem CID 91137834) has the molecular formula C18H16O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(2-hydroxy-4-methoxyphenyl)-2-methoxypropane-1,3-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(2-hydroxy-4-methoxyphenyl)-2-methoxypropane-1,3-dione |
|---|---|
| PubChem CID | 91137834 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(2-hydroxy-4-methoxyphenyl)-2-methoxypropane-1,3-dione |
| SMILES | COc1ccc(C(=O)C(OC)C(=O)c2ccc3c(c2)OCO3)c(O)c1 |
| InChI | InChI=1S/C18H16O7/c1-22-11-4-5-12(13(19)8-11)17(21)18(23-2)16(20)10-3-6-14-15(7-10)25-9-24-14/h3-8,18-19H,9H2,1-2H3 |
| InChIKey | IWBAYUJOSWUWKQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|