C17H16N2O4 — CID 6255410
N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 6255410) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 6255410 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H16N2O4/c1-11(12-3-6-14(21-2)7-4-12)18-19-17(20)13-5-8-15-16(9-13)23-10-22-15/h3-9H,10H2,1-2H3,(H,19,20)/b18-11- |
| InChIKey | PYUXEFQETJVTLE-WQRHYEAKSA-N |
| XLogP | 2.58 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|