C17H14F2N2O4 — CID 42991318
N-[(E)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 42991318) has the molecular formula C17H14F2N2O4 and a molecular weight of 348.31 g/mol. Its IUPAC name is N-[(E)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(E)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42991318 |
| Molecular Formula | C17H14F2N2O4 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-[(E)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccc2c(c1)OCO2)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H14F2N2O4/c1-10(11-2-5-13(6-3-11)25-17(18)19)20-21-16(22)12-4-7-14-15(8-12)24-9-23-14/h2-8,17H,9H2,1H3,(H,21,22)/b20-10+ |
| InChIKey | ILAJJGVCYYCHTI-KEBDBYFISA-N |
| XLogP | 3.17 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|