C18H16O6 — CID 42607652
(Z)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dimethoxyphenyl)-3-hydroxyprop-2-en-1-one (PubChem CID 42607652) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dimethoxyphenyl)-3-hydroxyprop-2-en-1-one.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dimethoxyphenyl)-3-hydroxyprop-2-en-1-one |
|---|---|
| PubChem CID | 42607652 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dimethoxyphenyl)-3-hydroxyprop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C(\O)c2ccc3c(c2)OCO3)c(OC)c1 |
| InChI | InChI=1S/C18H16O6/c1-21-12-4-5-13(17(8-12)22-2)15(20)9-14(19)11-3-6-16-18(7-11)24-10-23-16/h3-9,19H,10H2,1-2H3/b14-9- |
| InChIKey | MFEZQKKSZCXUBX-ZROIWOOFSA-N |
| XLogP | 3.21 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|