C19H18O5 — CID 5340533
(E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 5340533) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5340533 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc3c(c2)OCCO3)c(OC)c1 |
| InChI | InChI=1S/C19H18O5/c1-21-15-6-3-13(18(12-15)22-2)4-7-16(20)14-5-8-17-19(11-14)24-10-9-23-17/h3-8,11-12H,9-10H2,1-2H3/b7-4+ |
| InChIKey | ISZFTOOQHDANME-QPJJXVBHSA-N |
| XLogP | 3.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|