C18H15BrO5 — CID 73386196
3-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one (PubChem CID 73386196) has the molecular formula C18H15BrO5 and a molecular weight of 391.22 g/mol. Its IUPAC name is 3-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one.
| Compound Name | 3-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 73386196 |
| Molecular Formula | C18H15BrO5 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 3-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2ccc3c(c2)OCCO3)cc(Br)c1O |
| InChI | InChI=1S/C18H15BrO5/c1-22-17-9-11(8-13(19)18(17)21)2-4-14(20)12-3-5-15-16(10-12)24-7-6-23-15/h2-5,8-10,21H,6-7H2,1H3 |
| InChIKey | OHBCYSLITCSBEJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|