C19H17NO7 — CID 8831965
(E)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one (PubChem CID 8831965) has the molecular formula C19H17NO7 and a molecular weight of 371.35 g/mol. Its IUPAC name is (E)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8831965 |
| Molecular Formula | C19H17NO7 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (E)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc3c(c2)OCCCO3)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H17NO7/c1-25-18-10-12(9-14(19(18)22)20(23)24)3-5-15(21)13-4-6-16-17(11-13)27-8-2-7-26-16/h3-6,9-11,22H,2,7-8H2,1H3/b5-3+ |
| InChIKey | RRMJFQNDIXPJLG-HWKANZROSA-N |
| XLogP | 3.37 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|