C17H12F3NO5 — CID 6081728
(E)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 6081728) has the molecular formula C17H12F3NO5 and a molecular weight of 367.28 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6081728 |
| Molecular Formula | C17H12F3NO5 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2cccc(C(F)(F)F)c2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H12F3NO5/c1-26-15-8-10(7-13(16(15)23)21(24)25)5-6-14(22)11-3-2-4-12(9-11)17(18,19)20/h2-9,23H,1H3/b6-5+ |
| InChIKey | ZWBSPHSKKFLDAU-AATRIKPKSA-N |
| XLogP | 4.22 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|