C19H17F3O4 — CID 17391114
(E)-1-[3-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 17391114) has the molecular formula C19H17F3O4 and a molecular weight of 366.34 g/mol. Its IUPAC name is (E)-1-[3-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 17391114 |
| Molecular Formula | C19H17F3O4 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (E)-1-[3-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2cccc(C(F)(F)F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H17F3O4/c1-24-16-9-12(10-17(25-2)18(16)26-3)7-8-15(23)13-5-4-6-14(11-13)19(20,21)22/h4-11H,1-3H3/b8-7+ |
| InChIKey | YBCXUVODRBSHDQ-BQYQJAHWSA-N |
| XLogP | 4.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|