C30H30O8 — CID 71835462
3-(3,4,5-trimethoxyphenyl)-1-[4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-en-1-one (PubChem CID 71835462) has the molecular formula C30H30O8 and a molecular weight of 518.56 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)-1-[4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-en-1-one.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)-1-[4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 71835462 |
| Molecular Formula | C30H30O8 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)-1-[4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl]prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2ccc(C(=O)C=Cc3cc(OC)c(OC)c(OC)c3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C30H30O8/c1-33-25-15-19(16-26(34-2)29(25)37-5)7-13-23(31)21-9-11-22(12-10-21)24(32)14-8-20-17-27(35-3)30(38-6)28(18-20)36-4/h7-18H,1-6H3 |
| InChIKey | JGABKNAYCZRLJE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|