C23H26O5 — CID 70018708
(E)-1-[4-[(E)-pent-3-en-2-yl]oxyphenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 70018708) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is (E)-1-[4-[(E)-pent-3-en-2-yl]oxyphenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(E)-pent-3-en-2-yl]oxyphenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 70018708 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (E)-1-[4-[(E)-pent-3-en-2-yl]oxyphenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | C/C=C/C(C)Oc1ccc(C(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H26O5/c1-6-7-16(2)28-19-11-9-18(10-12-19)20(24)13-8-17-14-21(25-3)23(27-5)22(15-17)26-4/h6-16H,1-5H3/b7-6+,13-8+ |
| InChIKey | QDOALOOTFRTRMJ-GTTXMNNRSA-N |
| XLogP | 4.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|