C25H21BrO6 — CID 6125806
[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl] 2-bromobenzoate (PubChem CID 6125806) has the molecular formula C25H21BrO6 and a molecular weight of 497.34 g/mol. Its IUPAC name is [4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl] 2-bromobenzoate.
| Compound Name | [4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 6125806 |
| Molecular Formula | C25H21BrO6 |
| Molecular Weight | 497.34 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | [4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl] 2-bromobenzoate |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(OC(=O)c3ccccc3Br)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H21BrO6/c1-29-22-14-16(15-23(30-2)24(22)31-3)8-13-21(27)17-9-11-18(12-10-17)32-25(28)19-6-4-5-7-20(19)26/h4-15H,1-3H3/b13-8+ |
| InChIKey | RVCCINBPNHDJMG-MDWZMJQESA-N |
| XLogP | 5.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.34 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|