C25H21ClO6 — CID 6125059
[4-[(E)-3-(4-chlorophenyl)prop-2-enoyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 6125059) has the molecular formula C25H21ClO6 and a molecular weight of 452.89 g/mol. Its IUPAC name is [4-[(E)-3-(4-chlorophenyl)prop-2-enoyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[(E)-3-(4-chlorophenyl)prop-2-enoyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 6125059 |
| Molecular Formula | C25H21ClO6 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | [4-[(E)-3-(4-chlorophenyl)prop-2-enoyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc(C(=O)/C=C/c3ccc(Cl)cc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H21ClO6/c1-29-22-14-18(15-23(30-2)24(22)31-3)25(28)32-20-11-7-17(8-12-20)21(27)13-6-16-4-9-19(26)10-5-16/h4-15H,1-3H3/b13-6+ |
| InChIKey | YOIAYTSPRDTTRH-AWNIVKPZSA-N |
| XLogP | 5.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|