C27H24O8 — CID 6125448
[4-[(E)-3-(4-methoxycarbonylphenyl)prop-2-enoyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 6125448) has the molecular formula C27H24O8 and a molecular weight of 476.48 g/mol. Its IUPAC name is [4-[(E)-3-(4-methoxycarbonylphenyl)prop-2-enoyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[(E)-3-(4-methoxycarbonylphenyl)prop-2-enoyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 6125448 |
| Molecular Formula | C27H24O8 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | [4-[(E)-3-(4-methoxycarbonylphenyl)prop-2-enoyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)c2ccc(OC(=O)c3cc(OC)c(OC)c(OC)c3)cc2)cc1 |
| InChI | InChI=1S/C27H24O8/c1-31-23-15-20(16-24(32-2)25(23)33-3)27(30)35-21-12-10-18(11-13-21)22(28)14-7-17-5-8-19(9-6-17)26(29)34-4/h5-16H,1-4H3/b14-7+ |
| InChIKey | RSVJJLFWXXPDQB-VGOFMYFVSA-N |
| XLogP | 4.61 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|