C26H22O8 — CID 6125159
[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 6125159) has the molecular formula C26H22O8 and a molecular weight of 462.45 g/mol. Its IUPAC name is [4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 6125159 |
| Molecular Formula | C26H22O8 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(OC(=O)c3ccc4c(c3)OCO4)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H22O8/c1-29-23-12-16(13-24(30-2)25(23)31-3)4-10-20(27)17-5-8-19(9-6-17)34-26(28)18-7-11-21-22(14-18)33-15-32-21/h4-14H,15H2,1-3H3/b10-4+ |
| InChIKey | ZCKISGVUVMGFSE-ONNFQVAWSA-N |
| XLogP | 4.56 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|