C17H13FO4 — CID 71835331
1-(4-fluorophenyl)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one (PubChem CID 71835331) has the molecular formula C17H13FO4 and a molecular weight of 300.29 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one.
| Compound Name | 1-(4-fluorophenyl)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71835331 |
| Molecular Formula | C17H13FO4 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2ccc(F)cc2)cc2c1OCO2 |
| InChI | InChI=1S/C17H13FO4/c1-20-15-8-11(9-16-17(15)22-10-21-16)2-7-14(19)12-3-5-13(18)6-4-12/h2-9H,10H2,1H3 |
| InChIKey | NFRNQATUQQMUPX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|