C15H19NO5 — CID 155093301
(E)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enoic acid;pyrrolidine (PubChem CID 155093301) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is (E)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enoic acid;pyrrolidine.
| Compound Name | (E)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enoic acid;pyrrolidine |
|---|---|
| PubChem CID | 155093301 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (E)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enoic acid;pyrrolidine |
| SMILES | C1CCNC1.COc1cc(/C=C/C(=O)O)cc2c1OCO2 |
| InChI | InChI=1S/C11H10O5.C4H9N/c1-14-8-4-7(2-3-10(12)13)5-9-11(8)16-6-15-9;1-2-4-5-3-1/h2-5H,6H2,1H3,(H,12,13);5H,1-4H2/b3-2+; |
| InChIKey | CXPOZIMEVYAPKL-SQQVDAMQSA-N |
| XLogP | 1.89 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|