C11H10O4 — CID 123758547
3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid (PubChem CID 123758547) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid.
| Compound Name | 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 123758547 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid |
| SMILES | Cc1cc(C=CC(=O)O)cc2c1OCO2 |
| InChI | InChI=1S/C11H10O4/c1-7-4-8(2-3-10(12)13)5-9-11(7)15-6-14-9/h2-5H,6H2,1H3,(H,12,13) |
| InChIKey | UDTQNBFGAOGXOA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|