3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid

C11H10O4 — CID 123758547

IUPAC3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid
SMILESCc1cc(C=CC(=O)O)cc2c1OCO2
InChIInChI=1S/C11H10O4/c1-7-4-8(2-3-10(12)13)5-9-11(7)15-6-14-9/h2-5H,6H2,1H3,(H,12,13)
InChIKeyUDTQNBFGAOGXOA-UHFFFAOYSA-N
MW206.20 g/mol
LogP1.82
Rot. Bonds2

About 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid

3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid (PubChem CID 123758547) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid
PubChem CID123758547
Molecular FormulaC11H10O4
Molecular Weight206.20 g/mol
Exact Mass206.06
IUPAC Name3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid
SMILESCc1cc(C=CC(=O)O)cc2c1OCO2
InChIInChI=1S/C11H10O4/c1-7-4-8(2-3-10(12)13)5-9-11(7)15-6-14-9/h2-5H,6H2,1H3,(H,12,13)
InChIKeyUDTQNBFGAOGXOA-UHFFFAOYSA-N
XLogP1.82
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.20
LogP ≤ 51.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid?
The IUPAC name of 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid (CID 123758547) is 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid.
What is the SMILES notation for 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid?
The canonical SMILES for 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid is Cc1cc(C=CC(=O)O)cc2c1OCO2.
What is the InChIKey of 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid?
The InChIKey is UDTQNBFGAOGXOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O4/c1-7-4-8(2-3-10(12)13)5-9-11(7)15-6-14-9/h2-5H,6H2,1H3,(H,12,13).
What are the key properties of 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid?
3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid has a molecular weight of 206.20 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-methyl-1,3-benzodioxol-5-yl)prop-2-enoic acid is sourced from PubChem (CID 123758547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).