C21H20O9 — CID 159501844
3-(1,3-benzodioxol-5-yl)prop-2-enoic acid;3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid (PubChem CID 159501844) has the molecular formula C21H20O9 and a molecular weight of 416.38 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)prop-2-enoic acid;3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)prop-2-enoic acid;3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 159501844 |
| Molecular Formula | C21H20O9 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)prop-2-enoic acid;3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)cc(OC)c1O.O=C(O)C=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H12O5.C10H8O4/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14;11-10(12)4-2-7-1-3-8-9(5-7)14-6-13-8/h3-6,14H,1-2H3,(H,12,13);1-5H,6H2,(H,11,12) |
| InChIKey | LZMHRQPACYBWLK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|