C13H12O4 — CID 173186075
(2E)-5-(1,3-benzodioxol-5-yl)-4-methylpenta-2,4-dienoic acid (PubChem CID 173186075) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is (2E)-5-(1,3-benzodioxol-5-yl)-4-methylpenta-2,4-dienoic acid.
| Compound Name | (2E)-5-(1,3-benzodioxol-5-yl)-4-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 173186075 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (2E)-5-(1,3-benzodioxol-5-yl)-4-methylpenta-2,4-dienoic acid |
| SMILES | CC(=Cc1ccc2c(c1)OCO2)/C=C/C(=O)O |
| InChI | InChI=1S/C13H12O4/c1-9(2-5-13(14)15)6-10-3-4-11-12(7-10)17-8-16-11/h2-7H,8H2,1H3,(H,14,15)/b5-2+,9-6? |
| InChIKey | PFLXFEQFSIDHSF-JBWUIUDUSA-N |
| XLogP | 2.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|