C13H14O4 — CID 130434088
(Z)-1-(1,3-benzodioxol-5-yl)-2-hydroxy-4-methylpent-1-en-3-one (PubChem CID 130434088) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is (Z)-1-(1,3-benzodioxol-5-yl)-2-hydroxy-4-methylpent-1-en-3-one.
| Compound Name | (Z)-1-(1,3-benzodioxol-5-yl)-2-hydroxy-4-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 130434088 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (Z)-1-(1,3-benzodioxol-5-yl)-2-hydroxy-4-methylpent-1-en-3-one |
| SMILES | CC(C)C(=O)/C(O)=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H14O4/c1-8(2)13(15)10(14)5-9-3-4-11-12(6-9)17-7-16-11/h3-6,8,14H,7H2,1-2H3/b10-5- |
| InChIKey | MKOVFUZLZGURHP-YHYXMXQVSA-N |
| XLogP | 2.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|