(E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid

C14H14O4 — CID 87842957

IUPAC(E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid
SMILESCCC(=C/c1ccc2c(c1)OCO2)/C=C/C(=O)O
InChIInChI=1S/C14H14O4/c1-2-10(4-6-14(15)16)7-11-3-5-12-13(8-11)18-9-17-12/h3-8H,2,9H2,1H3,(H,15,16)/b6-4+,10-7-
InChIKeyHAPJYNQWLWVDEY-JSRXJHBZSA-N
MW246.26 g/mol
LogP2.85
Rot. Bonds4

About (E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid

(E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid (PubChem CID 87842957) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is (E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid.

Molecular Properties

Compound Name(E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid
PubChem CID87842957
Molecular FormulaC14H14O4
Molecular Weight246.26 g/mol
Exact Mass246.09
IUPAC Name(E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid
SMILESCCC(=C/c1ccc2c(c1)OCO2)/C=C/C(=O)O
InChIInChI=1S/C14H14O4/c1-2-10(4-6-14(15)16)7-11-3-5-12-13(8-11)18-9-17-12/h3-8H,2,9H2,1H3,(H,15,16)/b6-4+,10-7-
InChIKeyHAPJYNQWLWVDEY-JSRXJHBZSA-N
XLogP2.85
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.26
LogP ≤ 52.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid?
The IUPAC name of (E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid (CID 87842957) is (E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid.
What is the SMILES notation for (E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid?
The canonical SMILES for (E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid is CCC(=C/c1ccc2c(c1)OCO2)/C=C/C(=O)O.
What is the InChIKey of (E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid?
The InChIKey is HAPJYNQWLWVDEY-JSRXJHBZSA-N. The full InChI is InChI=1S/C14H14O4/c1-2-10(4-6-14(15)16)7-11-3-5-12-13(8-11)18-9-17-12/h3-8H,2,9H2,1H3,(H,15,16)/b6-4+,10-7-.
What are the key properties of (E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid?
(E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid has a molecular weight of 246.26 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4Z)-4-(1,3-benzodioxol-5-ylmethylidene)hex-2-enoic acid is sourced from PubChem (CID 87842957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).