C20H14O8 — CID 11090237
(2E,3E)-2,3-bis(1,3-benzodioxol-5-ylmethylidene)butanedioic acid (PubChem CID 11090237) has the molecular formula C20H14O8 and a molecular weight of 382.32 g/mol. Its IUPAC name is (2E,3E)-2,3-bis(1,3-benzodioxol-5-ylmethylidene)butanedioic acid.
| Compound Name | (2E,3E)-2,3-bis(1,3-benzodioxol-5-ylmethylidene)butanedioic acid |
|---|---|
| PubChem CID | 11090237 |
| Molecular Formula | C20H14O8 |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (2E,3E)-2,3-bis(1,3-benzodioxol-5-ylmethylidene)butanedioic acid |
| SMILES | O=C(O)C(=C/c1ccc2c(c1)OCO2)/C(=C\c1ccc2c(c1)OCO2)C(=O)O |
| InChI | InChI=1S/C20H14O8/c21-19(22)13(5-11-1-3-15-17(7-11)27-9-25-15)14(20(23)24)6-12-2-4-16-18(8-12)28-10-26-16/h1-8H,9-10H2,(H,21,22)(H,23,24)/b13-5+,14-6+ |
| InChIKey | BFGVJWYCQSEQET-ACFHMISVSA-N |
| XLogP | 2.78 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|