C20H13NO5 — CID 4675600
4-(1,3-benzodioxol-5-yl)-2-oxo-3-quinolin-2-ylbut-3-enoic acid (PubChem CID 4675600) has the molecular formula C20H13NO5 and a molecular weight of 347.33 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-oxo-3-quinolin-2-ylbut-3-enoic acid.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-oxo-3-quinolin-2-ylbut-3-enoic acid |
|---|---|
| PubChem CID | 4675600 |
| Molecular Formula | C20H13NO5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-oxo-3-quinolin-2-ylbut-3-enoic acid |
| SMILES | O=C(O)C(=O)C(=Cc1ccc2c(c1)OCO2)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C20H13NO5/c22-19(20(23)24)14(9-12-5-8-17-18(10-12)26-11-25-17)16-7-6-13-3-1-2-4-15(13)21-16/h1-10H,11H2,(H,23,24) |
| InChIKey | JEBDVZWHWREEDI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|