C24H17NO4 — CID 2926638
3-(1,3-benzodioxol-5-yl)-2-(1,3-benzoxazol-2-yl)-1-(4-methylphenyl)prop-2-en-1-one (PubChem CID 2926638) has the molecular formula C24H17NO4 and a molecular weight of 383.40 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-(1,3-benzoxazol-2-yl)-1-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-(1,3-benzoxazol-2-yl)-1-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2926638 |
| Molecular Formula | C24H17NO4 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-(1,3-benzoxazol-2-yl)-1-(4-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)C(=Cc2ccc3c(c2)OCO3)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C24H17NO4/c1-15-6-9-17(10-7-15)23(26)18(24-25-19-4-2-3-5-20(19)29-24)12-16-8-11-21-22(13-16)28-14-27-21/h2-13H,14H2,1H3 |
| InChIKey | UXJXCJSRFNNHEK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|