C26H23NO5 — CID 5252929
2-(1,3-benzoxazol-2-yl)-3-(3,4-dimethoxyphenyl)-1-(4-ethoxyphenyl)prop-2-en-1-one (PubChem CID 5252929) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-3-(3,4-dimethoxyphenyl)-1-(4-ethoxyphenyl)prop-2-en-1-one.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-3-(3,4-dimethoxyphenyl)-1-(4-ethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5252929 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-3-(3,4-dimethoxyphenyl)-1-(4-ethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C(=O)C(=Cc2ccc(OC)c(OC)c2)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C26H23NO5/c1-4-31-19-12-10-18(11-13-19)25(28)20(26-27-21-7-5-6-8-22(21)32-26)15-17-9-14-23(29-2)24(16-17)30-3/h5-16H,4H2,1-3H3 |
| InChIKey | ZSBOCSJLGCTJOY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|