C25H22N2O3 — CID 6067905
(E)-2-(1,3-benzoxazol-2-yl)-1-(4-butoxyphenyl)-3-pyridin-3-ylprop-2-en-1-one (PubChem CID 6067905) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-yl)-1-(4-butoxyphenyl)-3-pyridin-3-ylprop-2-en-1-one.
| Compound Name | (E)-2-(1,3-benzoxazol-2-yl)-1-(4-butoxyphenyl)-3-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 6067905 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-yl)-1-(4-butoxyphenyl)-3-pyridin-3-ylprop-2-en-1-one |
| SMILES | CCCCOc1ccc(C(=O)/C(=C/c2cccnc2)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C25H22N2O3/c1-2-3-15-29-20-12-10-19(11-13-20)24(28)21(16-18-7-6-14-26-17-18)25-27-22-8-4-5-9-23(22)30-25/h4-14,16-17H,2-3,15H2,1H3/b21-16- |
| InChIKey | BJTYIMFOJHJXQS-PGMHBOJBSA-N |
| XLogP | 5.83 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|