C30H24BrNO4 — CID 22307973
(Z)-2-(1,3-benzoxazol-2-yl)-3-[5-(4-bromophenyl)furan-2-yl]-1-(4-butoxyphenyl)prop-2-en-1-one (PubChem CID 22307973) has the molecular formula C30H24BrNO4 and a molecular weight of 542.43 g/mol. Its IUPAC name is (Z)-2-(1,3-benzoxazol-2-yl)-3-[5-(4-bromophenyl)furan-2-yl]-1-(4-butoxyphenyl)prop-2-en-1-one.
| Compound Name | (Z)-2-(1,3-benzoxazol-2-yl)-3-[5-(4-bromophenyl)furan-2-yl]-1-(4-butoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 22307973 |
| Molecular Formula | C30H24BrNO4 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | (Z)-2-(1,3-benzoxazol-2-yl)-3-[5-(4-bromophenyl)furan-2-yl]-1-(4-butoxyphenyl)prop-2-en-1-one |
| SMILES | CCCCOc1ccc(C(=O)/C(=C\c2ccc(-c3ccc(Br)cc3)o2)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C30H24BrNO4/c1-2-3-18-34-23-14-10-21(11-15-23)29(33)25(30-32-26-6-4-5-7-28(26)36-30)19-24-16-17-27(35-24)20-8-12-22(31)13-9-20/h4-17,19H,2-3,18H2,1H3/b25-19+ |
| InChIKey | VHHDHPIXGUQWAU-NCELDCMTSA-N |
| XLogP | 8.45 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|