C26H22ClNO3 — CID 4142634
2-(1,3-benzoxazol-2-yl)-1-(4-butoxyphenyl)-3-(2-chlorophenyl)prop-2-en-1-one (PubChem CID 4142634) has the molecular formula C26H22ClNO3 and a molecular weight of 431.92 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-1-(4-butoxyphenyl)-3-(2-chlorophenyl)prop-2-en-1-one.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-1-(4-butoxyphenyl)-3-(2-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4142634 |
| Molecular Formula | C26H22ClNO3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-1-(4-butoxyphenyl)-3-(2-chlorophenyl)prop-2-en-1-one |
| SMILES | CCCCOc1ccc(C(=O)C(=Cc2ccccc2Cl)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C26H22ClNO3/c1-2-3-16-30-20-14-12-18(13-15-20)25(29)21(17-19-8-4-5-9-22(19)27)26-28-23-10-6-7-11-24(23)31-26/h4-15,17H,2-3,16H2,1H3 |
| InChIKey | GRRBNEFLAINRPX-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|