C33H28ClNO5 — CID 4634835
2-(1,3-benzoxazol-2-yl)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-1-(4-propoxyphenyl)prop-2-en-1-one (PubChem CID 4634835) has the molecular formula C33H28ClNO5 and a molecular weight of 554.04 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-1-(4-propoxyphenyl)prop-2-en-1-one.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-1-(4-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4634835 |
| Molecular Formula | C33H28ClNO5 |
| Molecular Weight | 554.04 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-1-(4-propoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1ccc(C(=O)C(=Cc2ccc(OCc3ccc(Cl)cc3)c(OC)c2)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C33H28ClNO5/c1-3-18-38-26-15-11-24(12-16-26)32(36)27(33-35-28-6-4-5-7-29(28)40-33)19-23-10-17-30(31(20-23)37-2)39-21-22-8-13-25(34)14-9-22/h4-17,19-20H,3,18,21H2,1-2H3 |
| InChIKey | WQAIKZXTRCVCHW-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.04 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|