C34H30ClNO5 — CID 4634841
2-(1,3-benzoxazol-2-yl)-1-(4-butoxyphenyl)-3-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-en-1-one (PubChem CID 4634841) has the molecular formula C34H30ClNO5 and a molecular weight of 568.07 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-1-(4-butoxyphenyl)-3-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-en-1-one.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-1-(4-butoxyphenyl)-3-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4634841 |
| Molecular Formula | C34H30ClNO5 |
| Molecular Weight | 568.07 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-1-(4-butoxyphenyl)-3-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-en-1-one |
| SMILES | CCCCOc1ccc(C(=O)C(=Cc2ccc(OCc3ccccc3Cl)c(OC)c2)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C34H30ClNO5/c1-3-4-19-39-26-16-14-24(15-17-26)33(37)27(34-36-29-11-7-8-12-30(29)41-34)20-23-13-18-31(32(21-23)38-2)40-22-25-9-5-6-10-28(25)35/h5-18,20-21H,3-4,19,22H2,1-2H3 |
| InChIKey | PTXIWSFQUIKHSG-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.07 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|