C29H21Cl2NO4 — CID 3500276
2-(1,3-benzoxazol-2-yl)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-1-(4-propoxyphenyl)prop-2-en-1-one (PubChem CID 3500276) has the molecular formula C29H21Cl2NO4 and a molecular weight of 518.40 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-1-(4-propoxyphenyl)prop-2-en-1-one.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-1-(4-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3500276 |
| Molecular Formula | C29H21Cl2NO4 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-1-(4-propoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1ccc(C(=O)C(=Cc2ccc(-c3ccc(Cl)c(Cl)c3)o2)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C29H21Cl2NO4/c1-2-15-34-20-10-7-18(8-11-20)28(33)22(29-32-25-5-3-4-6-27(25)36-29)17-21-12-14-26(35-21)19-9-13-23(30)24(31)16-19/h3-14,16-17H,2,15H2,1H3 |
| InChIKey | KXFQITWKELYOAO-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|