C29H22BrNO4 — CID 71952275
2-(1,3-benzoxazol-2-yl)-3-[5-(4-bromophenyl)furan-2-yl]-1-(4-propoxyphenyl)prop-2-en-1-one (PubChem CID 71952275) has the molecular formula C29H22BrNO4 and a molecular weight of 528.40 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-3-[5-(4-bromophenyl)furan-2-yl]-1-(4-propoxyphenyl)prop-2-en-1-one.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-3-[5-(4-bromophenyl)furan-2-yl]-1-(4-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71952275 |
| Molecular Formula | C29H22BrNO4 |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-3-[5-(4-bromophenyl)furan-2-yl]-1-(4-propoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1ccc(C(=O)C(=Cc2ccc(-c3ccc(Br)cc3)o2)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C29H22BrNO4/c1-2-17-33-22-13-9-20(10-14-22)28(32)24(29-31-25-5-3-4-6-27(25)35-29)18-23-15-16-26(34-23)19-7-11-21(30)12-8-19/h3-16,18H,2,17H2,1H3 |
| InChIKey | MLOXDURVIYWHSQ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|