C28H27NO6 — CID 3651677
2-(1,3-benzoxazol-2-yl)-1-(4-propoxyphenyl)-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 3651677) has the molecular formula C28H27NO6 and a molecular weight of 473.53 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-1-(4-propoxyphenyl)-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-1-(4-propoxyphenyl)-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3651677 |
| Molecular Formula | C28H27NO6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-1-(4-propoxyphenyl)-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1ccc(C(=O)C(=Cc2cc(OC)c(OC)cc2OC)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C28H27NO6/c1-5-14-34-20-12-10-18(11-13-20)27(30)21(28-29-22-8-6-7-9-23(22)35-28)15-19-16-25(32-3)26(33-4)17-24(19)31-2/h6-13,15-17H,5,14H2,1-4H3 |
| InChIKey | XSRJNBZFULPTER-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|