C28H27NO3 — CID 6293204
(E)-2-(1,3-benzoxazol-2-yl)-3-(4-propan-2-ylphenyl)-1-(4-propoxyphenyl)prop-2-en-1-one (PubChem CID 6293204) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-yl)-3-(4-propan-2-ylphenyl)-1-(4-propoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-2-(1,3-benzoxazol-2-yl)-3-(4-propan-2-ylphenyl)-1-(4-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6293204 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-yl)-3-(4-propan-2-ylphenyl)-1-(4-propoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1ccc(C(=O)/C(=C/c2ccc(C(C)C)cc2)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C28H27NO3/c1-4-17-31-23-15-13-22(14-16-23)27(30)24(18-20-9-11-21(12-10-20)19(2)3)28-29-25-7-5-6-8-26(25)32-28/h5-16,18-19H,4,17H2,1-3H3/b24-18- |
| InChIKey | HFDROJLHVNYNGZ-MOHJPFBDSA-N |
| XLogP | 7.16 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|