C25H18N2O5 — CID 126073208
4-[[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126073208) has the molecular formula C25H18N2O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is 4-[[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126073208 |
| Molecular Formula | C25H18N2O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 4-[[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C(\C#N)c2nc3ccccc3o2)ccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H18N2O5/c1-30-23-13-17(12-19(14-26)24-27-20-4-2-3-5-21(20)32-24)8-11-22(23)31-15-16-6-9-18(10-7-16)25(28)29/h2-13H,15H2,1H3,(H,28,29)/b19-12+ |
| InChIKey | MLGMGNZUHNKYCM-XDHOZWIPSA-N |
| XLogP | 5.18 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|