C24H15BrN2O4 — CID 126077959
4-[[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2-bromophenoxy]methyl]benzoic acid (PubChem CID 126077959) has the molecular formula C24H15BrN2O4 and a molecular weight of 475.30 g/mol. Its IUPAC name is 4-[[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2-bromophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2-bromophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126077959 |
| Molecular Formula | C24H15BrN2O4 |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | 4-[[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2-bromophenoxy]methyl]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(OCc2ccc(C(=O)O)cc2)c(Br)c1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C24H15BrN2O4/c25-19-12-16(11-18(13-26)23-27-20-3-1-2-4-22(20)31-23)7-10-21(19)30-14-15-5-8-17(9-6-15)24(28)29/h1-12H,14H2,(H,28,29)/b18-11+ |
| InChIKey | KIWMHDBSOGVNPE-WOJGMQOQSA-N |
| XLogP | 5.93 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|