C23H13Cl2N3O4 — CID 126050233
(E)-2-(1,3-benzoxazol-2-yl)-3-[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 126050233) has the molecular formula C23H13Cl2N3O4 and a molecular weight of 466.28 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-yl)-3-[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzoxazol-2-yl)-3-[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126050233 |
| Molecular Formula | C23H13Cl2N3O4 |
| Molecular Weight | 466.28 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-yl)-3-[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Cl)c(OCc2ccc([N+](=O)[O-])cc2)c(Cl)c1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C23H13Cl2N3O4/c24-18-10-15(9-16(12-26)23-27-20-3-1-2-4-21(20)32-23)11-19(25)22(18)31-13-14-5-7-17(8-6-14)28(29)30/h1-11H,13H2/b16-9+ |
| InChIKey | APFQBNRYLKTLTO-CXUHLZMHSA-N |
| XLogP | 6.69 |
| TPSA | 102.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.28 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|