C22H13Cl3N2O3 — CID 126049120
(Z)-3-[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 126049120) has the molecular formula C22H13Cl3N2O3 and a molecular weight of 459.72 g/mol. Its IUPAC name is (Z)-3-[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126049120 |
| Molecular Formula | C22H13Cl3N2O3 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | (Z)-3-[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Cl)c(OCc2ccccc2Cl)c(Cl)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H13Cl3N2O3/c23-19-4-2-1-3-16(19)13-30-22-20(24)10-14(11-21(22)25)9-17(12-26)15-5-7-18(8-6-15)27(28)29/h1-11H,13H2/b17-9+ |
| InChIKey | ODCWPJOWDGSDRK-RQZCQDPDSA-N |
| XLogP | 7.20 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|