C16H9N3O3 — CID 3833962
2-(1,3-benzoxazol-2-yl)-3-(3-nitrophenyl)prop-2-enenitrile (PubChem CID 3833962) has the molecular formula C16H9N3O3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-3-(3-nitrophenyl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-3-(3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3833962 |
| Molecular Formula | C16H9N3O3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-3-(3-nitrophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cccc([N+](=O)[O-])c1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C16H9N3O3/c17-10-12(8-11-4-3-5-13(9-11)19(20)21)16-18-14-6-1-2-7-15(14)22-16/h1-9H |
| InChIKey | XEGLLDFKCXGJGX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|