C16H9ClN2O — CID 3707219
2-(1,3-benzoxazol-2-yl)-3-(4-chlorophenyl)prop-2-enenitrile (PubChem CID 3707219) has the molecular formula C16H9ClN2O and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-3-(4-chlorophenyl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-3-(4-chlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3707219 |
| Molecular Formula | C16H9ClN2O |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-3-(4-chlorophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(Cl)cc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C16H9ClN2O/c17-13-7-5-11(6-8-13)9-12(10-18)16-19-14-3-1-2-4-15(14)20-16/h1-9H |
| InChIKey | CXBWMZZGWDVTAU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|