C16H11N3O2 — CID 16740228
(E)-2-(1,3-benzoxazol-2-yl)-3-(4-hydroxyanilino)prop-2-enenitrile (PubChem CID 16740228) has the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-yl)-3-(4-hydroxyanilino)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzoxazol-2-yl)-3-(4-hydroxyanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 16740228 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-yl)-3-(4-hydroxyanilino)prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1ccc(O)cc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C16H11N3O2/c17-9-11(10-18-12-5-7-13(20)8-6-12)16-19-14-3-1-2-4-15(14)21-16/h1-8,10,18,20H/b11-10+ |
| InChIKey | DTCKGTYLFCLVDF-ZHACJKMWSA-N |
| XLogP | 3.51 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|