C19H13N5O3S2 — CID 18528439
4-[[(Z)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 18528439) has the molecular formula C19H13N5O3S2 and a molecular weight of 423.48 g/mol. Its IUPAC name is 4-[[(Z)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[(Z)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 18528439 |
| Molecular Formula | C19H13N5O3S2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 4-[[(Z)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | N#C/C(=C/Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C19H13N5O3S2/c20-11-13(18-23-16-3-1-2-4-17(16)27-18)12-22-14-5-7-15(8-6-14)29(25,26)24-19-21-9-10-28-19/h1-10,12,22H,(H,21,24)/b13-12- |
| InChIKey | OQRACNBGQRUWDG-SEYXRHQNSA-N |
| XLogP | 4.06 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|