C24H14BrN5O4S3 — CID 3951334
4-[[2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 3951334) has the molecular formula C24H14BrN5O4S3 and a molecular weight of 612.51 g/mol. Its IUPAC name is 4-[[2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3951334 |
| Molecular Formula | C24H14BrN5O4S3 |
| Molecular Weight | 612.51 g/mol |
| Exact Mass | 610.94 |
| IUPAC Name | 4-[[2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | N#CC(=CNc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1nc(-c2cc3cc(Br)ccc3oc2=O)cs1 |
| InChI | InChI=1S/C24H14BrN5O4S3/c25-16-1-6-21-14(9-16)10-19(23(31)34-21)20-13-36-22(29-20)15(11-26)12-28-17-2-4-18(5-3-17)37(32,33)30-24-27-7-8-35-24/h1-10,12-13,28H,(H,27,30) |
| InChIKey | ITCDUFMBYYYDHE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|