C22H10BrClF3N3O2S — CID 4872117
2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[4-chloro-2-(trifluoromethyl)anilino]prop-2-enenitrile (PubChem CID 4872117) has the molecular formula C22H10BrClF3N3O2S and a molecular weight of 552.76 g/mol. Its IUPAC name is 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[4-chloro-2-(trifluoromethyl)anilino]prop-2-enenitrile.
| Compound Name | 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[4-chloro-2-(trifluoromethyl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 4872117 |
| Molecular Formula | C22H10BrClF3N3O2S |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 550.93 |
| IUPAC Name | 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-[4-chloro-2-(trifluoromethyl)anilino]prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(Cl)cc1C(F)(F)F)c1nc(-c2cc3cc(Br)ccc3oc2=O)cs1 |
| InChI | InChI=1S/C22H10BrClF3N3O2S/c23-13-1-4-19-11(5-13)6-15(21(31)32-19)18-10-33-20(30-18)12(8-28)9-29-17-3-2-14(24)7-16(17)22(25,26)27/h1-7,9-10,29H |
| InChIKey | VHBOBNLFVKQALY-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|